C45H30F9NO2 — CID 143481047
N,N-bis[4-[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]phenyl]-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]aniline (PubChem CID 143481047) has the molecular formula C45H30F9NO2 and a molecular weight of 787.72 g/mol. Its IUPAC name is N,N-bis[4-[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]phenyl]-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]aniline.
| Compound Name | N,N-bis[4-[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]phenyl]-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]aniline |
|---|---|
| PubChem CID | 143481047 |
| Molecular Formula | C45H30F9NO2 |
| Molecular Weight | 787.72 g/mol |
| Exact Mass | 787.21 |
| IUPAC Name | N,N-bis[4-[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]phenyl]-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]aniline |
| SMILES | FC(F)(F)Oc1ccc(/C=C/c2ccc(N(c3ccc(/C=C/c4ccc(OC(F)(F)F)cc4)cc3)c3ccc(/C=C/c4ccc(C(F)(F)F)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C45H30F9NO2/c46-43(47,48)37-19-7-31(8-20-37)1-2-32-9-21-38(22-10-32)55(39-23-11-33(12-24-39)3-5-35-15-27-41(28-16-35)56-44(49,50)51)40-25-13-34(14-26-40)4-6-36-17-29-42(30-18-36)57-45(52,53)54/h1-30H/b2-1+,5-3+,6-4+ |
| InChIKey | QUTAVHONTFHDAE-CRQXNEITSA-N |
| XLogP | 14.48 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.72 |
| LogP ≤ 5 | 14.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|