C17H15F3 — CID 76576198
1-ethyl-4-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzene (PubChem CID 76576198) has the molecular formula C17H15F3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 1-ethyl-4-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzene.
| Compound Name | 1-ethyl-4-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 76576198 |
| Molecular Formula | C17H15F3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-ethyl-4-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzene |
| SMILES | CCc1ccc(C=Cc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H15F3/c1-2-13-3-5-14(6-4-13)7-8-15-9-11-16(12-10-15)17(18,19)20/h3-12H,2H2,1H3 |
| InChIKey | YNIUXQDYOHHVRE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|