C32H20F6 — CID 59221378
1-(trifluoromethyl)-4-[(E)-2-[4-[2-[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]ethynyl]phenyl]ethenyl]benzene (PubChem CID 59221378) has the molecular formula C32H20F6 and a molecular weight of 518.50 g/mol. Its IUPAC name is 1-(trifluoromethyl)-4-[(E)-2-[4-[2-[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]ethynyl]phenyl]ethenyl]benzene.
| Compound Name | 1-(trifluoromethyl)-4-[(E)-2-[4-[2-[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]ethynyl]phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 59221378 |
| Molecular Formula | C32H20F6 |
| Molecular Weight | 518.50 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | 1-(trifluoromethyl)-4-[(E)-2-[4-[2-[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]ethynyl]phenyl]ethenyl]benzene |
| SMILES | FC(F)(F)c1ccc(/C=C/c2ccc(C#Cc3ccc(/C=C/c4ccc(C(F)(F)F)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H20F6/c33-31(34,35)29-19-15-27(16-20-29)13-11-25-7-3-23(4-8-25)1-2-24-5-9-26(10-6-24)12-14-28-17-21-30(22-18-28)32(36,37)38/h3-22H/b13-11+,14-12+ |
| InChIKey | SDTRMAFFRIUDDJ-PHEQNACWSA-N |
| XLogP | 9.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.50 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|