C23H17F3 — CID 56950894
1-[(E)-2-phenylethenyl]-3-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzene (PubChem CID 56950894) has the molecular formula C23H17F3 and a molecular weight of 350.38 g/mol. Its IUPAC name is 1-[(E)-2-phenylethenyl]-3-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzene.
| Compound Name | 1-[(E)-2-phenylethenyl]-3-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 56950894 |
| Molecular Formula | C23H17F3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-[(E)-2-phenylethenyl]-3-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzene |
| SMILES | FC(F)(F)c1ccc(/C=C/c2cccc(/C=C/c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C23H17F3/c24-23(25,26)22-15-13-19(14-16-22)10-12-21-8-4-7-20(17-21)11-9-18-5-2-1-3-6-18/h1-17H/b11-9+,12-10+ |
| InChIKey | IPVTWRVEVHKXNB-WGDLNXRISA-N |
| XLogP | 7.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|