C22H28 — CID 164762812
1-tert-butyl-3-[(E)-2-(4-tert-butylphenyl)ethenyl]benzene (PubChem CID 164762812) has the molecular formula C22H28 and a molecular weight of 292.47 g/mol. Its IUPAC name is 1-tert-butyl-3-[(E)-2-(4-tert-butylphenyl)ethenyl]benzene.
| Compound Name | 1-tert-butyl-3-[(E)-2-(4-tert-butylphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 164762812 |
| Molecular Formula | C22H28 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1-tert-butyl-3-[(E)-2-(4-tert-butylphenyl)ethenyl]benzene |
| SMILES | CC(C)(C)c1ccc(/C=C/c2cccc(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C22H28/c1-21(2,3)19-14-12-17(13-15-19)10-11-18-8-7-9-20(16-18)22(4,5)6/h7-16H,1-6H3/b11-10+ |
| InChIKey | LJAQUJQGWXRMHZ-ZHACJKMWSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|