C38H50 — CID 14708009
1,3-ditert-butyl-5-[(E)-2-[4-[(E)-2-(3,5-ditert-butylphenyl)ethenyl]phenyl]ethenyl]benzene (PubChem CID 14708009) has the molecular formula C38H50 and a molecular weight of 506.82 g/mol. Its IUPAC name is 1,3-ditert-butyl-5-[(E)-2-[4-[(E)-2-(3,5-ditert-butylphenyl)ethenyl]phenyl]ethenyl]benzene.
| Compound Name | 1,3-ditert-butyl-5-[(E)-2-[4-[(E)-2-(3,5-ditert-butylphenyl)ethenyl]phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 14708009 |
| Molecular Formula | C38H50 |
| Molecular Weight | 506.82 g/mol |
| Exact Mass | 506.39 |
| IUPAC Name | 1,3-ditert-butyl-5-[(E)-2-[4-[(E)-2-(3,5-ditert-butylphenyl)ethenyl]phenyl]ethenyl]benzene |
| SMILES | CC(C)(C)c1cc(/C=C/c2ccc(/C=C/c3cc(C(C)(C)C)cc(C(C)(C)C)c3)cc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C38H50/c1-35(2,3)31-21-29(22-32(25-31)36(4,5)6)19-17-27-13-15-28(16-14-27)18-20-30-23-33(37(7,8)9)26-34(24-30)38(10,11)12/h13-26H,1-12H3/b19-17+,20-18+ |
| InChIKey | YTMGCGREUWEJLX-XPWSMXQVSA-N |
| XLogP | 11.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.82 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|