C70H70N2 — CID 130303941
2,7-bis[4-[(E)-2-(3,5-ditert-butylphenyl)ethenyl]phenyl]-5,10-diphenylindolo[3,2-b]indole (PubChem CID 130303941) has the molecular formula C70H70N2 and a molecular weight of 939.34 g/mol. Its IUPAC name is 2,7-bis[4-[(E)-2-(3,5-ditert-butylphenyl)ethenyl]phenyl]-5,10-diphenylindolo[3,2-b]indole.
| Compound Name | 2,7-bis[4-[(E)-2-(3,5-ditert-butylphenyl)ethenyl]phenyl]-5,10-diphenylindolo[3,2-b]indole |
|---|---|
| PubChem CID | 130303941 |
| Molecular Formula | C70H70N2 |
| Molecular Weight | 939.34 g/mol |
| Exact Mass | 938.55 |
| IUPAC Name | 2,7-bis[4-[(E)-2-(3,5-ditert-butylphenyl)ethenyl]phenyl]-5,10-diphenylindolo[3,2-b]indole |
| SMILES | CC(C)(C)c1cc(/C=C/c2ccc(-c3ccc4c(c3)n(-c3ccccc3)c3c5ccc(-c6ccc(/C=C/c7cc(C(C)(C)C)cc(C(C)(C)C)c7)cc6)cc5n(-c5ccccc5)c43)cc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C70H70N2/c1-67(2,3)55-39-49(40-56(45-55)68(4,5)6)25-23-47-27-31-51(32-28-47)53-35-37-61-63(43-53)71(59-19-15-13-16-20-59)66-62-38-36-54(44-64(62)72(65(61)66)60-21-17-14-18-22-60)52-33-29-48(30-34-52)24-26-50-41-57(69(7,8)9)46-58(42-50)70(10,11)12/h13-46H,1-12H3/b25-23+,26-24+ |
| InChIKey | VEXKLPAILMFKAA-OGGGYYITSA-N |
| XLogP | 19.59 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.34 |
| LogP ≤ 5 | 19.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|