C30H44 — CID 4625492
1,3-ditert-butyl-5-[2-(3,5-ditert-butylphenyl)ethenyl]benzene (PubChem CID 4625492) has the molecular formula C30H44 and a molecular weight of 404.68 g/mol. Its IUPAC name is 1,3-ditert-butyl-5-[2-(3,5-ditert-butylphenyl)ethenyl]benzene.
| Compound Name | 1,3-ditert-butyl-5-[2-(3,5-ditert-butylphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 4625492 |
| Molecular Formula | C30H44 |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 404.34 |
| IUPAC Name | 1,3-ditert-butyl-5-[2-(3,5-ditert-butylphenyl)ethenyl]benzene |
| SMILES | CC(C)(C)c1cc(C=Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H44/c1-27(2,3)23-15-21(16-24(19-23)28(4,5)6)13-14-22-17-25(29(7,8)9)20-26(18-22)30(10,11)12/h13-20H,1-12H3 |
| InChIKey | COYBCPIRNMSVNL-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|