About 3-(3,5-ditert-butylphenyl)prop-2-enyl-bis(2-methylpropyl)alumane
3-(3,5-ditert-butylphenyl)prop-2-enyl-bis(2-methylpropyl)alumane (PubChem CID 173177670) has the molecular formula C25H43Al
and a molecular weight of 370.60 g/mol. Its IUPAC name is 3-(3,5-ditert-butylphenyl)prop-2-enyl-bis(2-methylpropyl)alumane.
Molecular Properties
| Compound Name | 3-(3,5-ditert-butylphenyl)prop-2-enyl-bis(2-methylpropyl)alumane |
| PubChem CID | 173177670 |
| Molecular Formula | C25H43Al |
| Molecular Weight | 370.60 g/mol |
| Exact Mass | 370.32 |
| IUPAC Name | 3-(3,5-ditert-butylphenyl)prop-2-enyl-bis(2-methylpropyl)alumane |
| SMILES | CC(C)C[Al](CC=Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1)CC(C)C |
| InChI | InChI=1S/C17H25.2C4H9.Al/c1-8-9-13-10-14(16(2,3)4)12-15(11-13)17(5,6)7;2*1-4(2)3;/h8-12H,1H2,2-7H3;2*4H,1H2,2-3H3; |
| InChIKey | XRURKTQBCSUNCH-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.60 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-(3,5-ditert-butylphenyl)prop-2-enyl-bis(2-methylpropyl)alumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-ditert-butylphenyl)prop-2-enyl-bis(2-methylpropyl)alumane?
The IUPAC name of 3-(3,5-ditert-butylphenyl)prop-2-enyl-bis(2-methylpropyl)alumane (CID 173177670) is 3-(3,5-ditert-butylphenyl)prop-2-enyl-bis(2-methylpropyl)alumane.
What is the SMILES notation for 3-(3,5-ditert-butylphenyl)prop-2-enyl-bis(2-methylpropyl)alumane?
The canonical SMILES for 3-(3,5-ditert-butylphenyl)prop-2-enyl-bis(2-methylpropyl)alumane is CC(C)C[Al](CC=Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1)CC(C)C.
What is the InChIKey of 3-(3,5-ditert-butylphenyl)prop-2-enyl-bis(2-methylpropyl)alumane?
The InChIKey is XRURKTQBCSUNCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25.2C4H9.Al/c1-8-9-13-10-14(16(2,3)4)12-15(11-13)17(5,6)7;2*1-4(2)3;/h8-12H,1H2,2-7H3;2*4H,1H2,2-3H3;.
What are the key properties of 3-(3,5-ditert-butylphenyl)prop-2-enyl-bis(2-methylpropyl)alumane?
3-(3,5-ditert-butylphenyl)prop-2-enyl-bis(2-methylpropyl)alumane has a molecular weight of 370.60 g/mol, XLogP of 8.10, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-ditert-butylphenyl)prop-2-enyl-bis(2-methylpropyl)alumane is sourced from PubChem (CID 173177670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).