C20H32O — CID 175121205
5-(3,5-ditert-butylphenyl)-4-methylpent-4-en-2-ol (PubChem CID 175121205) has the molecular formula C20H32O and a molecular weight of 288.47 g/mol. Its IUPAC name is 5-(3,5-ditert-butylphenyl)-4-methylpent-4-en-2-ol.
| Compound Name | 5-(3,5-ditert-butylphenyl)-4-methylpent-4-en-2-ol |
|---|---|
| PubChem CID | 175121205 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.47 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 5-(3,5-ditert-butylphenyl)-4-methylpent-4-en-2-ol |
| SMILES | CC(=Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1)CC(C)O |
| InChI | InChI=1S/C20H32O/c1-14(9-15(2)21)10-16-11-17(19(3,4)5)13-18(12-16)20(6,7)8/h10-13,15,21H,9H2,1-8H3 |
| InChIKey | FFRQFUVSJVROPJ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.47 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |