C19H31NS — CID 130474035
(E)-N-tert-butylsulfanyl-1-(3,5-ditert-butylphenyl)methanimine (PubChem CID 130474035) has the molecular formula C19H31NS and a molecular weight of 305.53 g/mol. Its IUPAC name is (E)-N-tert-butylsulfanyl-1-(3,5-ditert-butylphenyl)methanimine.
| Compound Name | (E)-N-tert-butylsulfanyl-1-(3,5-ditert-butylphenyl)methanimine |
|---|---|
| PubChem CID | 130474035 |
| Molecular Formula | C19H31NS |
| Molecular Weight | 305.53 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | (E)-N-tert-butylsulfanyl-1-(3,5-ditert-butylphenyl)methanimine |
| SMILES | CC(C)(C)S/N=C/c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H31NS/c1-17(2,3)15-10-14(13-20-21-19(7,8)9)11-16(12-15)18(4,5)6/h10-13H,1-9H3/b20-13+ |
| InChIKey | MGSPIRCNGVRYDC-DEDYPNTBSA-N |
| XLogP | 6.15 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.53 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|