C10H12Br2N2S — CID 134275991
(Z)-N-tert-butylsulfanyl-1-(3,6-dibromo-2-pyridinyl)methanimine (PubChem CID 134275991) has the molecular formula C10H12Br2N2S and a molecular weight of 352.10 g/mol. Its IUPAC name is (Z)-N-tert-butylsulfanyl-1-(3,6-dibromo-2-pyridinyl)methanimine.
| Compound Name | (Z)-N-tert-butylsulfanyl-1-(3,6-dibromo-2-pyridinyl)methanimine |
|---|---|
| PubChem CID | 134275991 |
| Molecular Formula | C10H12Br2N2S |
| Molecular Weight | 352.10 g/mol |
| Exact Mass | 349.91 |
| IUPAC Name | (Z)-N-tert-butylsulfanyl-1-(3,6-dibromo-2-pyridinyl)methanimine |
| SMILES | CC(C)(C)S/N=C\c1nc(Br)ccc1Br |
| InChI | InChI=1S/C10H12Br2N2S/c1-10(2,3)15-13-6-8-7(11)4-5-9(12)14-8/h4-6H,1-3H3/b13-6- |
| InChIKey | WHVUZUNKCDKIIR-MLPAPPSSSA-N |
| XLogP | 4.47 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.10 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|