C11H13BrN4S — CID 142466340
(E)-1-(5-bromo-1H-pyrazolo[3,4-b]pyridin-6-yl)-N-tert-butylsulfanylmethanimine (PubChem CID 142466340) has the molecular formula C11H13BrN4S and a molecular weight of 313.22 g/mol. Its IUPAC name is (E)-1-(5-bromo-1H-pyrazolo[3,4-b]pyridin-6-yl)-N-tert-butylsulfanylmethanimine.
| Compound Name | (E)-1-(5-bromo-1H-pyrazolo[3,4-b]pyridin-6-yl)-N-tert-butylsulfanylmethanimine |
|---|---|
| PubChem CID | 142466340 |
| Molecular Formula | C11H13BrN4S |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | (E)-1-(5-bromo-1H-pyrazolo[3,4-b]pyridin-6-yl)-N-tert-butylsulfanylmethanimine |
| SMILES | CC(C)(C)S/N=C/c1nc2[nH]ncc2cc1Br |
| InChI | InChI=1S/C11H13BrN4S/c1-11(2,3)17-14-6-9-8(12)4-7-5-13-16-10(7)15-9/h4-6H,1-3H3,(H,13,15,16)/b14-6+ |
| InChIKey | XKRUGPDVVWCJQA-MKMNVTDBSA-N |
| XLogP | 3.59 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|