C9H14BrN5S — CID 4131210
1-[(4-bromo-1H-pyrazol-5-yl)methylideneamino]-3-tert-butylthiourea (PubChem CID 4131210) has the molecular formula C9H14BrN5S and a molecular weight of 304.22 g/mol. Its IUPAC name is 1-[(4-bromo-1H-pyrazol-5-yl)methylideneamino]-3-tert-butylthiourea.
| Compound Name | 1-[(4-bromo-1H-pyrazol-5-yl)methylideneamino]-3-tert-butylthiourea |
|---|---|
| PubChem CID | 4131210 |
| Molecular Formula | C9H14BrN5S |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 1-[(4-bromo-1H-pyrazol-5-yl)methylideneamino]-3-tert-butylthiourea |
| SMILES | CC(C)(C)NC(=S)NN=Cc1[nH]ncc1Br |
| InChI | InChI=1S/C9H14BrN5S/c1-9(2,3)13-8(16)15-12-5-7-6(10)4-11-14-7/h4-5H,1-3H3,(H,11,14)(H2,13,15,16) |
| InChIKey | QMPPDWLFMMJBCJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|