C12H15F2N3S — CID 131990815
1-tert-butyl-3-[(E)-(3,4-difluorophenyl)methylideneamino]thiourea (PubChem CID 131990815) has the molecular formula C12H15F2N3S and a molecular weight of 271.34 g/mol. Its IUPAC name is 1-tert-butyl-3-[(E)-(3,4-difluorophenyl)methylideneamino]thiourea.
| Compound Name | 1-tert-butyl-3-[(E)-(3,4-difluorophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 131990815 |
| Molecular Formula | C12H15F2N3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 1-tert-butyl-3-[(E)-(3,4-difluorophenyl)methylideneamino]thiourea |
| SMILES | CC(C)(C)NC(=S)N/N=C/c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H15F2N3S/c1-12(2,3)16-11(18)17-15-7-8-4-5-9(13)10(14)6-8/h4-7H,1-3H3,(H2,16,17,18)/b15-7+ |
| InChIKey | BNJRKGPOZQMPQL-VIZOYTHASA-N |
| XLogP | 2.56 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|