C10H11ClFN3 — CID 145167085
(E)-1-N'-[(E)-(3-chloro-4-fluorophenyl)methylideneamino]prop-1-ene-1,1-diamine (PubChem CID 145167085) has the molecular formula C10H11ClFN3 and a molecular weight of 227.67 g/mol. Its IUPAC name is (E)-1-N'-[(E)-(3-chloro-4-fluorophenyl)methylideneamino]prop-1-ene-1,1-diamine.
| Compound Name | (E)-1-N'-[(E)-(3-chloro-4-fluorophenyl)methylideneamino]prop-1-ene-1,1-diamine |
|---|---|
| PubChem CID | 145167085 |
| Molecular Formula | C10H11ClFN3 |
| Molecular Weight | 227.67 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | (E)-1-N'-[(E)-(3-chloro-4-fluorophenyl)methylideneamino]prop-1-ene-1,1-diamine |
| SMILES | C/C=C(\N)N/N=C/c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C10H11ClFN3/c1-2-10(13)15-14-6-7-3-4-9(12)8(11)5-7/h2-6,15H,13H2,1H3/b10-2+,14-6+ |
| InChIKey | PWEWFCGVFQQEHY-DIVYRFJWSA-N |
| XLogP | 2.22 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.67 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|