C17H16ClFN4O2 — CID 19660151
N-(3-chloro-4-fluorophenyl)-N'-[(E)-[4-(dimethylamino)phenyl]methylideneamino]oxamide (PubChem CID 19660151) has the molecular formula C17H16ClFN4O2 and a molecular weight of 362.79 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-N'-[(E)-[4-(dimethylamino)phenyl]methylideneamino]oxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-N'-[(E)-[4-(dimethylamino)phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 19660151 |
| Molecular Formula | C17H16ClFN4O2 |
| Molecular Weight | 362.79 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-N'-[(E)-[4-(dimethylamino)phenyl]methylideneamino]oxamide |
| SMILES | CN(C)c1ccc(/C=N/NC(=O)C(=O)Nc2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H16ClFN4O2/c1-23(2)13-6-3-11(4-7-13)10-20-22-17(25)16(24)21-12-5-8-15(19)14(18)9-12/h3-10H,1-2H3,(H,21,24)(H,22,25)/b20-10+ |
| InChIKey | SPGVEUUXFZPNAH-KEBDBYFISA-N |
| XLogP | 2.63 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.79 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|