C16H11ClFN3O4 — CID 5046834
N'-(1,3-benzodioxol-5-ylmethylideneamino)-N-(3-chloro-4-fluorophenyl)oxamide (PubChem CID 5046834) has the molecular formula C16H11ClFN3O4 and a molecular weight of 363.73 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-5-ylmethylideneamino)-N-(3-chloro-4-fluorophenyl)oxamide.
| Compound Name | N'-(1,3-benzodioxol-5-ylmethylideneamino)-N-(3-chloro-4-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 5046834 |
| Molecular Formula | C16H11ClFN3O4 |
| Molecular Weight | 363.73 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | N'-(1,3-benzodioxol-5-ylmethylideneamino)-N-(3-chloro-4-fluorophenyl)oxamide |
| SMILES | O=C(NN=Cc1ccc2c(c1)OCO2)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H11ClFN3O4/c17-11-6-10(2-3-12(11)18)20-15(22)16(23)21-19-7-9-1-4-13-14(5-9)25-8-24-13/h1-7H,8H2,(H,20,22)(H,21,23) |
| InChIKey | LENCFNRLFZKUGG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.73 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|