C17H13N3O6 — CID 3937826
N-(1,3-benzodioxol-5-yl)-N'-(1,3-benzodioxol-5-ylmethylideneamino)oxamide (PubChem CID 3937826) has the molecular formula C17H13N3O6 and a molecular weight of 355.31 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N'-(1,3-benzodioxol-5-ylmethylideneamino)oxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N'-(1,3-benzodioxol-5-ylmethylideneamino)oxamide |
|---|---|
| PubChem CID | 3937826 |
| Molecular Formula | C17H13N3O6 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N'-(1,3-benzodioxol-5-ylmethylideneamino)oxamide |
| SMILES | O=C(NN=Cc1ccc2c(c1)OCO2)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H13N3O6/c21-16(19-11-2-4-13-15(6-11)26-9-24-13)17(22)20-18-7-10-1-3-12-14(5-10)25-8-23-12/h1-7H,8-9H2,(H,19,21)(H,20,22) |
| InChIKey | JJAFYDTVZRIIQR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|