C15H12N2O4 — CID 5357673
N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-hydroxybenzamide (PubChem CID 5357673) has the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-hydroxybenzamide.
| Compound Name | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 5357673 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-hydroxybenzamide |
| SMILES | O=C(N/N=C\c1ccc2c(c1)OCO2)c1ccccc1O |
| InChI | InChI=1S/C15H12N2O4/c18-12-4-2-1-3-11(12)15(19)17-16-8-10-5-6-13-14(7-10)21-9-20-13/h1-8,18H,9H2,(H,17,19)/b16-8- |
| InChIKey | XSOVDKJJBAEXAA-PXNMLYILSA-N |
| XLogP | 1.88 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|