C17H12N2O3S — CID 842303
N-(1,3-benzodioxol-5-ylmethylideneamino)-1-benzothiophene-3-carboxamide (PubChem CID 842303) has the molecular formula C17H12N2O3S and a molecular weight of 324.36 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethylideneamino)-1-benzothiophene-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethylideneamino)-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 842303 |
| Molecular Formula | C17H12N2O3S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethylideneamino)-1-benzothiophene-3-carboxamide |
| SMILES | O=C(NN=Cc1ccc2c(c1)OCO2)c1csc2ccccc12 |
| InChI | InChI=1S/C17H12N2O3S/c20-17(13-9-23-16-4-2-1-3-12(13)16)19-18-8-11-5-6-14-15(7-11)22-10-21-14/h1-9H,10H2,(H,19,20) |
| InChIKey | VSBCCXSSMIMJBO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|