C18H15NO3S — CID 24610243
N-[1-(1,3-benzodioxol-5-yl)ethyl]-1-benzothiophene-3-carboxamide (PubChem CID 24610243) has the molecular formula C18H15NO3S and a molecular weight of 325.39 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-1-benzothiophene-3-carboxamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 24610243 |
| Molecular Formula | C18H15NO3S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-1-benzothiophene-3-carboxamide |
| SMILES | CC(NC(=O)c1csc2ccccc12)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H15NO3S/c1-11(12-6-7-15-16(8-12)22-10-21-15)19-18(20)14-9-23-17-5-3-2-4-13(14)17/h2-9,11H,10H2,1H3,(H,19,20) |
| InChIKey | CKUUZJLSMZXXLB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |