C17H17NO4 — CID 51323702
N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-hydroxy-4-methylbenzamide (PubChem CID 51323702) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-hydroxy-4-methylbenzamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-hydroxy-4-methylbenzamide |
|---|---|
| PubChem CID | 51323702 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-hydroxy-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(C)c2ccc3c(c2)OCO3)c(O)c1 |
| InChI | InChI=1S/C17H17NO4/c1-10-3-5-13(14(19)7-10)17(20)18-11(2)12-4-6-15-16(8-12)22-9-21-15/h3-8,11,19H,9H2,1-2H3,(H,18,20) |
| InChIKey | WAYMDLWUVQTTJR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |