C12H16N2O3 — CID 43403044
2-[1-(1,3-benzodioxol-5-yl)ethylamino]propanamide (PubChem CID 43403044) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-[1-(1,3-benzodioxol-5-yl)ethylamino]propanamide.
| Compound Name | 2-[1-(1,3-benzodioxol-5-yl)ethylamino]propanamide |
|---|---|
| PubChem CID | 43403044 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2-[1-(1,3-benzodioxol-5-yl)ethylamino]propanamide |
| SMILES | CC(NC(C)c1ccc2c(c1)OCO2)C(N)=O |
| InChI | InChI=1S/C12H16N2O3/c1-7(14-8(2)12(13)15)9-3-4-10-11(5-9)17-6-16-10/h3-5,7-8,14H,6H2,1-2H3,(H2,13,15) |
| InChIKey | DKAYJSRSIDACOY-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |