C10H11NO3S — CID 14529286
2-(1,3-benzodioxol-5-yl)-2-methylsulfanylacetamide (PubChem CID 14529286) has the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-2-methylsulfanylacetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 14529286 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-2-methylsulfanylacetamide |
| SMILES | CSC(C(N)=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H11NO3S/c1-15-9(10(11)12)6-2-3-7-8(4-6)14-5-13-7/h2-4,9H,5H2,1H3,(H2,11,12) |
| InChIKey | JHALOHFGKZMTGZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |