C16H14O6 — CID 11185720
(1R,2R)-1,2-bis(1,3-benzodioxol-5-yl)ethane-1,2-diol (PubChem CID 11185720) has the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. Its IUPAC name is (1R,2R)-1,2-bis(1,3-benzodioxol-5-yl)ethane-1,2-diol.
| Compound Name | (1R,2R)-1,2-bis(1,3-benzodioxol-5-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 11185720 |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | (1R,2R)-1,2-bis(1,3-benzodioxol-5-yl)ethane-1,2-diol |
| SMILES | O[C@H](c1ccc2c(c1)OCO2)[C@H](O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H14O6/c17-15(9-1-3-11-13(5-9)21-7-19-11)16(18)10-2-4-12-14(6-10)22-8-20-12/h1-6,15-18H,7-8H2/t15-,16-/m1/s1 |
| InChIKey | ZRPMNODCXDTMNY-HZPDHXFCSA-N |
| XLogP | 1.91 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |