C8H7BrO3 — CID 141431420
1,3-benzodioxol-5-yl(bromo)methanol (PubChem CID 141431420) has the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl(bromo)methanol.
| Compound Name | 1,3-benzodioxol-5-yl(bromo)methanol |
|---|---|
| PubChem CID | 141431420 |
| Molecular Formula | C8H7BrO3 |
| Molecular Weight | 231.04 g/mol |
| Exact Mass | 229.96 |
| IUPAC Name | 1,3-benzodioxol-5-yl(bromo)methanol |
| SMILES | OC(Br)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C8H7BrO3/c9-8(10)5-1-2-6-7(3-5)12-4-11-6/h1-3,8,10H,4H2 |
| InChIKey | CGKBUGHTBQJZDR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.04 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|