C10H10O3 — CID 11651236
(1S)-1-(1,3-benzodioxol-5-yl)prop-2-en-1-ol (PubChem CID 11651236) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is (1S)-1-(1,3-benzodioxol-5-yl)prop-2-en-1-ol.
| Compound Name | (1S)-1-(1,3-benzodioxol-5-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 11651236 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | (1S)-1-(1,3-benzodioxol-5-yl)prop-2-en-1-ol |
| SMILES | C=C[C@H](O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H10O3/c1-2-8(11)7-3-4-9-10(5-7)13-6-12-9/h2-5,8,11H,1,6H2/t8-/m0/s1 |
| InChIKey | VVBJNJFYBCLUAH-QMMMGPOBSA-N |
| XLogP | 1.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|