C10H13NO3 — CID 93258024
(1S,2R)-2-amino-1-(1,3-benzodioxol-5-yl)propan-1-ol (PubChem CID 93258024) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is (1S,2R)-2-amino-1-(1,3-benzodioxol-5-yl)propan-1-ol.
| Compound Name | (1S,2R)-2-amino-1-(1,3-benzodioxol-5-yl)propan-1-ol |
|---|---|
| PubChem CID | 93258024 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (1S,2R)-2-amino-1-(1,3-benzodioxol-5-yl)propan-1-ol |
| SMILES | C[C@@H](N)[C@@H](O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H13NO3/c1-6(11)10(12)7-2-3-8-9(4-7)14-5-13-8/h2-4,6,10,12H,5,11H2,1H3/t6-,10-/m1/s1 |
| InChIKey | GGNJMBKLSUPVBI-LHLIQPBNSA-N |
| XLogP | 0.80 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |