C10H11ClO4 — CID 171862183
1-(1,3-benzodioxol-5-yl)-3-chloropropane-1,2-diol (PubChem CID 171862183) has the molecular formula C10H11ClO4 and a molecular weight of 230.65 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-chloropropane-1,2-diol.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-chloropropane-1,2-diol |
|---|---|
| PubChem CID | 171862183 |
| Molecular Formula | C10H11ClO4 |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-chloropropane-1,2-diol |
| SMILES | OC(CCl)C(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H11ClO4/c11-4-7(12)10(13)6-1-2-8-9(3-6)15-5-14-8/h1-3,7,10,12-13H,4-5H2 |
| InChIKey | NNHHTWKONDBYPM-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|