C11H12ClNO4 — CID 171862818
7-(3-chloro-1,2-dihydroxypropyl)-4H-1,4-benzoxazin-3-one (PubChem CID 171862818) has the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. Its IUPAC name is 7-(3-chloro-1,2-dihydroxypropyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-(3-chloro-1,2-dihydroxypropyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 171862818 |
| Molecular Formula | C11H12ClNO4 |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 7-(3-chloro-1,2-dihydroxypropyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cc(C(O)C(O)CCl)ccc2N1 |
| InChI | InChI=1S/C11H12ClNO4/c12-4-8(14)11(16)6-1-2-7-9(3-6)17-5-10(15)13-7/h1-3,8,11,14,16H,4-5H2,(H,13,15) |
| InChIKey | PZBRKMSQUWVLOL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|