C19H20N2O6 — CID 171856705
benzyl N-[2,3-dihydroxy-3-(3-oxo-4H-1,4-benzoxazin-6-yl)propyl]carbamate (PubChem CID 171856705) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is benzyl N-[2,3-dihydroxy-3-(3-oxo-4H-1,4-benzoxazin-6-yl)propyl]carbamate.
| Compound Name | benzyl N-[2,3-dihydroxy-3-(3-oxo-4H-1,4-benzoxazin-6-yl)propyl]carbamate |
|---|---|
| PubChem CID | 171856705 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | benzyl N-[2,3-dihydroxy-3-(3-oxo-4H-1,4-benzoxazin-6-yl)propyl]carbamate |
| SMILES | O=C1COc2ccc(C(O)C(O)CNC(=O)OCc3ccccc3)cc2N1 |
| InChI | InChI=1S/C19H20N2O6/c22-15(9-20-19(25)27-10-12-4-2-1-3-5-12)18(24)13-6-7-16-14(8-13)21-17(23)11-26-16/h1-8,15,18,22,24H,9-11H2,(H,20,25)(H,21,23) |
| InChIKey | JHQMKXWKHNQHIB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |