C17H21N3O4 — CID 171855602
benzyl N-[3-(4-hydrazinylphenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171855602) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is benzyl N-[3-(4-hydrazinylphenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(4-hydrazinylphenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171855602 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | benzyl N-[3-(4-hydrazinylphenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | NNc1ccc(C(O)C(O)CNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H21N3O4/c18-20-14-8-6-13(7-9-14)16(22)15(21)10-19-17(23)24-11-12-4-2-1-3-5-12/h1-9,15-16,20-22H,10-11,18H2,(H,19,23) |
| InChIKey | CAGGXKMDQCKSKR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|