C18H22N2O4 — CID 171855663
benzyl N-[2,3-dihydroxy-3-[4-(methylamino)phenyl]propyl]carbamate (PubChem CID 171855663) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is benzyl N-[2,3-dihydroxy-3-[4-(methylamino)phenyl]propyl]carbamate.
| Compound Name | benzyl N-[2,3-dihydroxy-3-[4-(methylamino)phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 171855663 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | benzyl N-[2,3-dihydroxy-3-[4-(methylamino)phenyl]propyl]carbamate |
| SMILES | CNc1ccc(C(O)C(O)CNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H22N2O4/c1-19-15-9-7-14(8-10-15)17(22)16(21)11-20-18(23)24-12-13-5-3-2-4-6-13/h2-10,16-17,19,21-22H,11-12H2,1H3,(H,20,23) |
| InChIKey | LDYBNYSBFQRFSV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |