C18H19NO5 — CID 171855537
benzyl N-[3-(4-formylphenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171855537) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is benzyl N-[3-(4-formylphenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(4-formylphenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171855537 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | benzyl N-[3-(4-formylphenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | O=Cc1ccc(C(O)C(O)CNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H19NO5/c20-11-13-6-8-15(9-7-13)17(22)16(21)10-19-18(23)24-12-14-4-2-1-3-5-14/h1-9,11,16-17,21-22H,10,12H2,(H,19,23) |
| InChIKey | DTZDCDUAOXFZDP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|