C16H18N2O5 — CID 171855425
benzyl N-[3-(5-formyl-1H-pyrrol-3-yl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171855425) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is benzyl N-[3-(5-formyl-1H-pyrrol-3-yl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(5-formyl-1H-pyrrol-3-yl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171855425 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | benzyl N-[3-(5-formyl-1H-pyrrol-3-yl)-2,3-dihydroxypropyl]carbamate |
| SMILES | O=Cc1cc(C(O)C(O)CNC(=O)OCc2ccccc2)c[nH]1 |
| InChI | InChI=1S/C16H18N2O5/c19-9-13-6-12(7-17-13)15(21)14(20)8-18-16(22)23-10-11-4-2-1-3-5-11/h1-7,9,14-15,17,20-21H,8,10H2,(H,18,22) |
| InChIKey | CWKQOILJIZAYHF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|