C18H18ClNO5 — CID 171855821
benzyl N-[3-(4-chloro-3-formylphenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171855821) has the molecular formula C18H18ClNO5 and a molecular weight of 363.80 g/mol. Its IUPAC name is benzyl N-[3-(4-chloro-3-formylphenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(4-chloro-3-formylphenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171855821 |
| Molecular Formula | C18H18ClNO5 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | benzyl N-[3-(4-chloro-3-formylphenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | O=Cc1cc(C(O)C(O)CNC(=O)OCc2ccccc2)ccc1Cl |
| InChI | InChI=1S/C18H18ClNO5/c19-15-7-6-13(8-14(15)10-21)17(23)16(22)9-20-18(24)25-11-12-4-2-1-3-5-12/h1-8,10,16-17,22-23H,9,11H2,(H,20,24) |
| InChIKey | HWRMFDSMANWOOF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|