C18H19NO6 — CID 171855779
benzyl N-[3-(3-formyl-4-hydroxyphenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171855779) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is benzyl N-[3-(3-formyl-4-hydroxyphenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(3-formyl-4-hydroxyphenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171855779 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | benzyl N-[3-(3-formyl-4-hydroxyphenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | O=Cc1cc(C(O)C(O)CNC(=O)OCc2ccccc2)ccc1O |
| InChI | InChI=1S/C18H19NO6/c20-10-14-8-13(6-7-15(14)21)17(23)16(22)9-19-18(24)25-11-12-4-2-1-3-5-12/h1-8,10,16-17,21-23H,9,11H2,(H,19,24) |
| InChIKey | UUDHAXVPJGQDCC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|