C18H20ClNO4 — CID 171855447
benzyl N-[3-[3-(chloromethyl)phenyl]-2,3-dihydroxypropyl]carbamate (PubChem CID 171855447) has the molecular formula C18H20ClNO4 and a molecular weight of 349.81 g/mol. Its IUPAC name is benzyl N-[3-[3-(chloromethyl)phenyl]-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-[3-(chloromethyl)phenyl]-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171855447 |
| Molecular Formula | C18H20ClNO4 |
| Molecular Weight | 349.81 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | benzyl N-[3-[3-(chloromethyl)phenyl]-2,3-dihydroxypropyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1cccc(CCl)c1)OCc1ccccc1 |
| InChI | InChI=1S/C18H20ClNO4/c19-10-14-7-4-8-15(9-14)17(22)16(21)11-20-18(23)24-12-13-5-2-1-3-6-13/h1-9,16-17,21-22H,10-12H2,(H,20,23) |
| InChIKey | UUBGEYQSSMQZJC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.81 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|