C20H23NO6 — CID 171856655
benzyl N-[3-[3-(1,3-dioxolan-2-yl)phenyl]-2,3-dihydroxypropyl]carbamate (PubChem CID 171856655) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is benzyl N-[3-[3-(1,3-dioxolan-2-yl)phenyl]-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-[3-(1,3-dioxolan-2-yl)phenyl]-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171856655 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | benzyl N-[3-[3-(1,3-dioxolan-2-yl)phenyl]-2,3-dihydroxypropyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1cccc(C2OCCO2)c1)OCc1ccccc1 |
| InChI | InChI=1S/C20H23NO6/c22-17(12-21-20(24)27-13-14-5-2-1-3-6-14)18(23)15-7-4-8-16(11-15)19-25-9-10-26-19/h1-8,11,17-19,22-23H,9-10,12-13H2,(H,21,24) |
| InChIKey | CLNNYUQOBICKOS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |