C15H19N3O4 — CID 171855323
benzyl N-[2,3-dihydroxy-3-(1-methylpyrazol-4-yl)propyl]carbamate (PubChem CID 171855323) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is benzyl N-[2,3-dihydroxy-3-(1-methylpyrazol-4-yl)propyl]carbamate.
| Compound Name | benzyl N-[2,3-dihydroxy-3-(1-methylpyrazol-4-yl)propyl]carbamate |
|---|---|
| PubChem CID | 171855323 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | benzyl N-[2,3-dihydroxy-3-(1-methylpyrazol-4-yl)propyl]carbamate |
| SMILES | Cn1cc(C(O)C(O)CNC(=O)OCc2ccccc2)cn1 |
| InChI | InChI=1S/C15H19N3O4/c1-18-9-12(7-17-18)14(20)13(19)8-16-15(21)22-10-11-5-3-2-4-6-11/h2-7,9,13-14,19-20H,8,10H2,1H3,(H,16,21) |
| InChIKey | YLGJEBHEBYCHCN-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |