C20H22N2O4 — CID 171857330
benzyl N-[2,3-dihydroxy-3-(1-methylindol-3-yl)propyl]carbamate (PubChem CID 171857330) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is benzyl N-[2,3-dihydroxy-3-(1-methylindol-3-yl)propyl]carbamate.
| Compound Name | benzyl N-[2,3-dihydroxy-3-(1-methylindol-3-yl)propyl]carbamate |
|---|---|
| PubChem CID | 171857330 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | benzyl N-[2,3-dihydroxy-3-(1-methylindol-3-yl)propyl]carbamate |
| SMILES | Cn1cc(C(O)C(O)CNC(=O)OCc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C20H22N2O4/c1-22-12-16(15-9-5-6-10-17(15)22)19(24)18(23)11-21-20(25)26-13-14-7-3-2-4-8-14/h2-10,12,18-19,23-24H,11,13H2,1H3,(H,21,25) |
| InChIKey | AZCZZVNTIXMKHN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |