benzyl N-(2,3-dihydroxy-3-phenanthren-9-ylpropyl)carbamate

C25H23NO4 — CID 171856946

IUPACbenzyl N-(2,3-dihydroxy-3-phenanthren-9-ylpropyl)carbamate
SMILESO=C(NCC(O)C(O)c1cc2ccccc2c2ccccc12)OCc1ccccc1
InChIInChI=1S/C25H23NO4/c27-23(15-26-25(29)30-16-17-8-2-1-3-9-17)24(28)22-14-18-10-4-5-11-19(18)20-12-6-7-13-21(20)22/h1-14,23-24,27-28H,15-16H2,(H,26,29)
InChIKeyGGXNPKIYGXICQY-UHFFFAOYSA-N
MW401.46 g/mol
LogP4.31
Rot. Bonds6

About benzyl N-(2,3-dihydroxy-3-phenanthren-9-ylpropyl)carbamate

benzyl N-(2,3-dihydroxy-3-phenanthren-9-ylpropyl)carbamate (PubChem CID 171856946) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is benzyl N-(2,3-dihydroxy-3-phenanthren-9-ylpropyl)carbamate.

Molecular Properties

Compound Namebenzyl N-(2,3-dihydroxy-3-phenanthren-9-ylpropyl)carbamate
PubChem CID171856946
Molecular FormulaC25H23NO4
Molecular Weight401.46 g/mol
Exact Mass401.16
IUPAC Namebenzyl N-(2,3-dihydroxy-3-phenanthren-9-ylpropyl)carbamate
SMILESO=C(NCC(O)C(O)c1cc2ccccc2c2ccccc12)OCc1ccccc1
InChIInChI=1S/C25H23NO4/c27-23(15-26-25(29)30-16-17-8-2-1-3-9-17)24(28)22-14-18-10-4-5-11-19(18)20-12-6-7-13-21(20)22/h1-14,23-24,27-28H,15-16H2,(H,26,29)
InChIKeyGGXNPKIYGXICQY-UHFFFAOYSA-N
XLogP4.31
TPSA78.79 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms30
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500401.46
LogP ≤ 54.31
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}

Analyze benzyl N-(2,3-dihydroxy-3-phenanthren-9-ylpropyl)carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl N-(2,3-dihydroxy-3-phenanthren-9-ylpropyl)carbamate?
The IUPAC name of benzyl N-(2,3-dihydroxy-3-phenanthren-9-ylpropyl)carbamate (CID 171856946) is benzyl N-(2,3-dihydroxy-3-phenanthren-9-ylpropyl)carbamate.
What is the SMILES notation for benzyl N-(2,3-dihydroxy-3-phenanthren-9-ylpropyl)carbamate?
The canonical SMILES for benzyl N-(2,3-dihydroxy-3-phenanthren-9-ylpropyl)carbamate is O=C(NCC(O)C(O)c1cc2ccccc2c2ccccc12)OCc1ccccc1.
What is the InChIKey of benzyl N-(2,3-dihydroxy-3-phenanthren-9-ylpropyl)carbamate?
The InChIKey is GGXNPKIYGXICQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23NO4/c27-23(15-26-25(29)30-16-17-8-2-1-3-9-17)24(28)22-14-18-10-4-5-11-19(18)20-12-6-7-13-21(20)22/h1-14,23-24,27-28H,15-16H2,(H,26,29).
What are the key properties of benzyl N-(2,3-dihydroxy-3-phenanthren-9-ylpropyl)carbamate?
benzyl N-(2,3-dihydroxy-3-phenanthren-9-ylpropyl)carbamate has a molecular weight of 401.46 g/mol, XLogP of 4.31, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-(2,3-dihydroxy-3-phenanthren-9-ylpropyl)carbamate is sourced from PubChem (CID 171856946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).