C25H23NO4 — CID 171856946
benzyl N-(2,3-dihydroxy-3-phenanthren-9-ylpropyl)carbamate (PubChem CID 171856946) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is benzyl N-(2,3-dihydroxy-3-phenanthren-9-ylpropyl)carbamate.
| Compound Name | benzyl N-(2,3-dihydroxy-3-phenanthren-9-ylpropyl)carbamate |
|---|---|
| PubChem CID | 171856946 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | benzyl N-(2,3-dihydroxy-3-phenanthren-9-ylpropyl)carbamate |
| SMILES | O=C(NCC(O)C(O)c1cc2ccccc2c2ccccc12)OCc1ccccc1 |
| InChI | InChI=1S/C25H23NO4/c27-23(15-26-25(29)30-16-17-8-2-1-3-9-17)24(28)22-14-18-10-4-5-11-19(18)20-12-6-7-13-21(20)22/h1-14,23-24,27-28H,15-16H2,(H,26,29) |
| InChIKey | GGXNPKIYGXICQY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|