C22H23NO5 — CID 171856731
benzyl N-[2,3-dihydroxy-3-(4-methoxynaphthalen-1-yl)propyl]carbamate (PubChem CID 171856731) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is benzyl N-[2,3-dihydroxy-3-(4-methoxynaphthalen-1-yl)propyl]carbamate.
| Compound Name | benzyl N-[2,3-dihydroxy-3-(4-methoxynaphthalen-1-yl)propyl]carbamate |
|---|---|
| PubChem CID | 171856731 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | benzyl N-[2,3-dihydroxy-3-(4-methoxynaphthalen-1-yl)propyl]carbamate |
| SMILES | COc1ccc(C(O)C(O)CNC(=O)OCc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C22H23NO5/c1-27-20-12-11-18(16-9-5-6-10-17(16)20)21(25)19(24)13-23-22(26)28-14-15-7-3-2-4-8-15/h2-12,19,21,24-25H,13-14H2,1H3,(H,23,26) |
| InChIKey | BFMHFCCVMMMDBR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |