C18H20BrNO5 — CID 171857152
benzyl N-[3-(2-bromo-4-methoxyphenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171857152) has the molecular formula C18H20BrNO5 and a molecular weight of 410.26 g/mol. Its IUPAC name is benzyl N-[3-(2-bromo-4-methoxyphenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(2-bromo-4-methoxyphenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171857152 |
| Molecular Formula | C18H20BrNO5 |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | benzyl N-[3-(2-bromo-4-methoxyphenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | COc1ccc(C(O)C(O)CNC(=O)OCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C18H20BrNO5/c1-24-13-7-8-14(15(19)9-13)17(22)16(21)10-20-18(23)25-11-12-5-3-2-4-6-12/h2-9,16-17,21-22H,10-11H2,1H3,(H,20,23) |
| InChIKey | JRGKHGTWDPYVHP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |