C19H23NO5 — CID 171855851
benzyl N-[2,3-dihydroxy-3-(5-methoxy-2-methylphenyl)propyl]carbamate (PubChem CID 171855851) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is benzyl N-[2,3-dihydroxy-3-(5-methoxy-2-methylphenyl)propyl]carbamate.
| Compound Name | benzyl N-[2,3-dihydroxy-3-(5-methoxy-2-methylphenyl)propyl]carbamate |
|---|---|
| PubChem CID | 171855851 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | benzyl N-[2,3-dihydroxy-3-(5-methoxy-2-methylphenyl)propyl]carbamate |
| SMILES | COc1ccc(C)c(C(O)C(O)CNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C19H23NO5/c1-13-8-9-15(24-2)10-16(13)18(22)17(21)11-20-19(23)25-12-14-6-4-3-5-7-14/h3-10,17-18,21-22H,11-12H2,1-2H3,(H,20,23) |
| InChIKey | BXITVBNGLIBGEQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |