benzyl N-[2,3-dihydroxy-3-(3-methylphenyl)propyl]carbamate

C18H21NO4 — CID 171855346

IUPACbenzyl N-[2,3-dihydroxy-3-(3-methylphenyl)propyl]carbamate
SMILESCc1cccc(C(O)C(O)CNC(=O)OCc2ccccc2)c1
InChIInChI=1S/C18H21NO4/c1-13-6-5-9-15(10-13)17(21)16(20)11-19-18(22)23-12-14-7-3-2-4-8-14/h2-10,16-17,20-21H,11-12H2,1H3,(H,19,22)
InChIKeyBERJVOGPOZQRSZ-UHFFFAOYSA-N
MW315.37 g/mol
LogP2.32
Rot. Bonds6

About benzyl N-[2,3-dihydroxy-3-(3-methylphenyl)propyl]carbamate

benzyl N-[2,3-dihydroxy-3-(3-methylphenyl)propyl]carbamate (PubChem CID 171855346) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is benzyl N-[2,3-dihydroxy-3-(3-methylphenyl)propyl]carbamate.

Molecular Properties

Compound Namebenzyl N-[2,3-dihydroxy-3-(3-methylphenyl)propyl]carbamate
PubChem CID171855346
Molecular FormulaC18H21NO4
Molecular Weight315.37 g/mol
Exact Mass315.15
IUPAC Namebenzyl N-[2,3-dihydroxy-3-(3-methylphenyl)propyl]carbamate
SMILESCc1cccc(C(O)C(O)CNC(=O)OCc2ccccc2)c1
InChIInChI=1S/C18H21NO4/c1-13-6-5-9-15(10-13)17(21)16(20)11-19-18(22)23-12-14-7-3-2-4-8-14/h2-10,16-17,20-21H,11-12H2,1H3,(H,19,22)
InChIKeyBERJVOGPOZQRSZ-UHFFFAOYSA-N
XLogP2.32
TPSA78.79 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500315.37
LogP ≤ 52.32
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze benzyl N-[2,3-dihydroxy-3-(3-methylphenyl)propyl]carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl N-[2,3-dihydroxy-3-(3-methylphenyl)propyl]carbamate?
The IUPAC name of benzyl N-[2,3-dihydroxy-3-(3-methylphenyl)propyl]carbamate (CID 171855346) is benzyl N-[2,3-dihydroxy-3-(3-methylphenyl)propyl]carbamate.
What is the SMILES notation for benzyl N-[2,3-dihydroxy-3-(3-methylphenyl)propyl]carbamate?
The canonical SMILES for benzyl N-[2,3-dihydroxy-3-(3-methylphenyl)propyl]carbamate is Cc1cccc(C(O)C(O)CNC(=O)OCc2ccccc2)c1.
What is the InChIKey of benzyl N-[2,3-dihydroxy-3-(3-methylphenyl)propyl]carbamate?
The InChIKey is BERJVOGPOZQRSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO4/c1-13-6-5-9-15(10-13)17(21)16(20)11-19-18(22)23-12-14-7-3-2-4-8-14/h2-10,16-17,20-21H,11-12H2,1H3,(H,19,22).
What are the key properties of benzyl N-[2,3-dihydroxy-3-(3-methylphenyl)propyl]carbamate?
benzyl N-[2,3-dihydroxy-3-(3-methylphenyl)propyl]carbamate has a molecular weight of 315.37 g/mol, XLogP of 2.32, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[2,3-dihydroxy-3-(3-methylphenyl)propyl]carbamate is sourced from PubChem (CID 171855346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).