C18H20FNO4 — CID 171855464
benzyl N-[3-(3-fluoro-5-methylphenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171855464) has the molecular formula C18H20FNO4 and a molecular weight of 333.36 g/mol. Its IUPAC name is benzyl N-[3-(3-fluoro-5-methylphenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(3-fluoro-5-methylphenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171855464 |
| Molecular Formula | C18H20FNO4 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | benzyl N-[3-(3-fluoro-5-methylphenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | Cc1cc(F)cc(C(O)C(O)CNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C18H20FNO4/c1-12-7-14(9-15(19)8-12)17(22)16(21)10-20-18(23)24-11-13-5-3-2-4-6-13/h2-9,16-17,21-22H,10-11H2,1H3,(H,20,23) |
| InChIKey | UYGRQEBLZXMQDV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |