C20H25NO7 — CID 171856816
benzyl N-[2,3-dihydroxy-3-(3,4,5-trimethoxyphenyl)propyl]carbamate (PubChem CID 171856816) has the molecular formula C20H25NO7 and a molecular weight of 391.42 g/mol. Its IUPAC name is benzyl N-[2,3-dihydroxy-3-(3,4,5-trimethoxyphenyl)propyl]carbamate.
| Compound Name | benzyl N-[2,3-dihydroxy-3-(3,4,5-trimethoxyphenyl)propyl]carbamate |
|---|---|
| PubChem CID | 171856816 |
| Molecular Formula | C20H25NO7 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | benzyl N-[2,3-dihydroxy-3-(3,4,5-trimethoxyphenyl)propyl]carbamate |
| SMILES | COc1cc(C(O)C(O)CNC(=O)OCc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H25NO7/c1-25-16-9-14(10-17(26-2)19(16)27-3)18(23)15(22)11-21-20(24)28-12-13-7-5-4-6-8-13/h4-10,15,18,22-23H,11-12H2,1-3H3,(H,21,24) |
| InChIKey | SZCIWVDDGFYIHB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |