C20H23NO7 — CID 171857086
benzyl N-[3-(5-formyl-2,3-dimethoxyphenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171857086) has the molecular formula C20H23NO7 and a molecular weight of 389.40 g/mol. Its IUPAC name is benzyl N-[3-(5-formyl-2,3-dimethoxyphenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(5-formyl-2,3-dimethoxyphenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171857086 |
| Molecular Formula | C20H23NO7 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | benzyl N-[3-(5-formyl-2,3-dimethoxyphenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | COc1cc(C=O)cc(C(O)C(O)CNC(=O)OCc2ccccc2)c1OC |
| InChI | InChI=1S/C20H23NO7/c1-26-17-9-14(11-22)8-15(19(17)27-2)18(24)16(23)10-21-20(25)28-12-13-6-4-3-5-7-13/h3-9,11,16,18,23-24H,10,12H2,1-2H3,(H,21,25) |
| InChIKey | OJMREDJFNDTHPH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|